C27H28ClN6OS+ — CID 4048734
1-(3-chloro-2-methylphenyl)-3-[2-hydroxy-1-[(4-phenylpiperazin-1-ium-1-yl)methyl]indol-3-yl]iminothiourea (PubChem CID 4048734) has the molecular formula C27H28ClN6OS+ and a molecular weight of 520.08 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[2-hydroxy-1-[(4-phenylpiperazin-1-ium-1-yl)methyl]indol-3-yl]iminothiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[2-hydroxy-1-[(4-phenylpiperazin-1-ium-1-yl)methyl]indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 4048734 |
| Molecular Formula | C27H28ClN6OS+ |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[2-hydroxy-1-[(4-phenylpiperazin-1-ium-1-yl)methyl]indol-3-yl]iminothiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)/N=N/c1c(O)n(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C27H27ClN6OS/c1-19-22(28)11-7-12-23(19)29-27(36)31-30-25-21-10-5-6-13-24(21)34(26(25)35)18-32-14-16-33(17-15-32)20-8-3-2-4-9-20/h2-13,35H,14-18H2,1H3,(H,29,36)/p+1/b31-30+ |
| InChIKey | PICNRCXDCDQMFY-NVQSTNCTSA-O |
| XLogP | 5.15 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|