C19H17FN4O3S — CID 135731034
ethyl 2-[3-[(2-fluorophenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]acetate (PubChem CID 135731034) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is ethyl 2-[3-[(2-fluorophenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(2-fluorophenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]acetate |
|---|---|
| PubChem CID | 135731034 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | ethyl 2-[3-[(2-fluorophenyl)carbamothioyldiazenyl]-2-hydroxyindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(O)c(/N=N/C(=S)Nc2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C19H17FN4O3S/c1-2-27-16(25)11-24-15-10-6-3-7-12(15)17(18(24)26)22-23-19(28)21-14-9-5-4-8-13(14)20/h3-10,26H,2,11H2,1H3,(H,21,28)/b23-22+ |
| InChIKey | OWJMSPUJXRSFSE-GHVJWSGMSA-N |
| XLogP | 4.53 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|