C25H29N5O4S — CID 135863233
ethyl 1-[[2-hydroxy-3-[(2-methoxyphenyl)carbamothioyldiazenyl]indol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 135863233) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is ethyl 1-[[2-hydroxy-3-[(2-methoxyphenyl)carbamothioyldiazenyl]indol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[2-hydroxy-3-[(2-methoxyphenyl)carbamothioyldiazenyl]indol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135863233 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | ethyl 1-[[2-hydroxy-3-[(2-methoxyphenyl)carbamothioyldiazenyl]indol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2c(O)c(/N=N/C(=S)Nc3ccccc3OC)c3ccccc32)CC1 |
| InChI | InChI=1S/C25H29N5O4S/c1-3-34-24(32)17-12-14-29(15-13-17)16-30-20-10-6-4-8-18(20)22(23(30)31)27-28-25(35)26-19-9-5-7-11-21(19)33-2/h4-11,17,31H,3,12-16H2,1-2H3,(H,26,35)/b28-27+ |
| InChIKey | DBKQHVIGBDWUIR-BYYHNAKLSA-N |
| XLogP | 5.07 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|