C30H40N6OS — CID 135863225
1-[1-[(4-cyclohexylpiperazin-1-yl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,6-diethylphenyl)thiourea (PubChem CID 135863225) has the molecular formula C30H40N6OS and a molecular weight of 532.76 g/mol. Its IUPAC name is 1-[1-[(4-cyclohexylpiperazin-1-yl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,6-diethylphenyl)thiourea.
| Compound Name | 1-[1-[(4-cyclohexylpiperazin-1-yl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,6-diethylphenyl)thiourea |
|---|---|
| PubChem CID | 135863225 |
| Molecular Formula | C30H40N6OS |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 1-[1-[(4-cyclohexylpiperazin-1-yl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,6-diethylphenyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)/N=N/c1c(O)n(CN2CCN(C3CCCCC3)CC2)c2ccccc12 |
| InChI | InChI=1S/C30H40N6OS/c1-3-22-11-10-12-23(4-2)27(22)31-30(38)33-32-28-25-15-8-9-16-26(25)36(29(28)37)21-34-17-19-35(20-18-34)24-13-6-5-7-14-24/h8-12,15-16,24,37H,3-7,13-14,17-21H2,1-2H3,(H,31,38)/b33-32+ |
| InChIKey | KVHYAORSGXITEK-ULIFNZDWSA-N |
| XLogP | 6.86 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|