C23H29N7OS — CID 135585480
1,1-diethyl-3-[2-hydroxy-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indol-3-yl]iminothiourea (PubChem CID 135585480) has the molecular formula C23H29N7OS and a molecular weight of 451.60 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-hydroxy-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indol-3-yl]iminothiourea.
| Compound Name | 1,1-diethyl-3-[2-hydroxy-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 135585480 |
| Molecular Formula | C23H29N7OS |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1,1-diethyl-3-[2-hydroxy-1-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indol-3-yl]iminothiourea |
| SMILES | CCN(CC)C(=S)/N=N/c1c(O)n(CN2CCN(c3ccccn3)CC2)c2ccccc12 |
| InChI | InChI=1S/C23H29N7OS/c1-3-28(4-2)23(32)26-25-21-18-9-5-6-10-19(18)30(22(21)31)17-27-13-15-29(16-14-27)20-11-7-8-12-24-20/h5-12,31H,3-4,13-17H2,1-2H3/b26-25+ |
| InChIKey | ZVIFWMQYLDGHSK-OCEACIFDSA-N |
| XLogP | 4.23 |
| TPSA | 72.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|