C28H31N5OS — CID 135491435
3-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]imino-1,1-diethylthiourea (PubChem CID 135491435) has the molecular formula C28H31N5OS and a molecular weight of 485.66 g/mol. Its IUPAC name is 3-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]imino-1,1-diethylthiourea.
| Compound Name | 3-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]imino-1,1-diethylthiourea |
|---|---|
| PubChem CID | 135491435 |
| Molecular Formula | C28H31N5OS |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 3-[1-[(dibenzylamino)methyl]-2-hydroxyindol-3-yl]imino-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)/N=N/c1c(O)n(CN(Cc2ccccc2)Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H31N5OS/c1-3-32(4-2)28(35)30-29-26-24-17-11-12-18-25(24)33(27(26)34)21-31(19-22-13-7-5-8-14-22)20-23-15-9-6-10-16-23/h5-18,34H,3-4,19-21H2,1-2H3/b30-29+ |
| InChIKey | DWWPVSNIFPGQMM-QVIHXGFCSA-N |
| XLogP | 6.72 |
| TPSA | 56.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|