C18H26N4OS — CID 20685
1,1-dibutyl-3-(2-hydroxy-1-methylindol-3-yl)iminothiourea (PubChem CID 20685) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 1,1-dibutyl-3-(2-hydroxy-1-methylindol-3-yl)iminothiourea.
| Compound Name | 1,1-dibutyl-3-(2-hydroxy-1-methylindol-3-yl)iminothiourea |
|---|---|
| PubChem CID | 20685 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1,1-dibutyl-3-(2-hydroxy-1-methylindol-3-yl)iminothiourea |
| SMILES | CCCCN(CCCC)C(=S)/N=N/c1c(O)n(C)c2ccccc12 |
| InChI | InChI=1S/C18H26N4OS/c1-4-6-12-22(13-7-5-2)18(24)20-19-16-14-10-8-9-11-15(14)21(3)17(16)23/h8-11,23H,4-7,12-13H2,1-3H3/b20-19+ |
| InChIKey | TVSIDOISFLKYAC-FMQUCBEESA-N |
| XLogP | 5.15 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|