C19H20BrN5OS — CID 135440154
[1-[[benzyl(ethyl)amino]methyl]-5-bromo-2-hydroxyindol-3-yl]iminothiourea (PubChem CID 135440154) has the molecular formula C19H20BrN5OS and a molecular weight of 446.37 g/mol. Its IUPAC name is [1-[[benzyl(ethyl)amino]methyl]-5-bromo-2-hydroxyindol-3-yl]iminothiourea.
| Compound Name | [1-[[benzyl(ethyl)amino]methyl]-5-bromo-2-hydroxyindol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 135440154 |
| Molecular Formula | C19H20BrN5OS |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | [1-[[benzyl(ethyl)amino]methyl]-5-bromo-2-hydroxyindol-3-yl]iminothiourea |
| SMILES | CCN(Cc1ccccc1)Cn1c(O)c(/N=N/C(N)=S)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H20BrN5OS/c1-2-24(11-13-6-4-3-5-7-13)12-25-16-9-8-14(20)10-15(16)17(18(25)26)22-23-19(21)27/h3-10,26H,2,11-12H2,1H3,(H2,21,27)/b23-22+ |
| InChIKey | CHJCHUGCZLXFQV-GHVJWSGMSA-N |
| XLogP | 4.92 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|