C25H30BrClN4O3 — CID 2321334
N-[5-bromo-1-(diethylaminomethyl)-2-hydroxyindol-3-yl]imino-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetamide (PubChem CID 2321334) has the molecular formula C25H30BrClN4O3 and a molecular weight of 549.90 g/mol. Its IUPAC name is N-[5-bromo-1-(diethylaminomethyl)-2-hydroxyindol-3-yl]imino-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[5-bromo-1-(diethylaminomethyl)-2-hydroxyindol-3-yl]imino-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 2321334 |
| Molecular Formula | C25H30BrClN4O3 |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | N-[5-bromo-1-(diethylaminomethyl)-2-hydroxyindol-3-yl]imino-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetamide |
| SMILES | CCN(CC)Cn1c(O)c(/N=N/C(=O)COc2cc(C)c(Cl)cc2C(C)C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H30BrClN4O3/c1-6-30(7-2)14-31-21-9-8-17(26)11-19(21)24(25(31)33)29-28-23(32)13-34-22-10-16(5)20(27)12-18(22)15(3)4/h8-12,15,33H,6-7,13-14H2,1-5H3/b29-28+ |
| InChIKey | WJPBHAUWZZTGSD-ZQHSETAFSA-N |
| XLogP | 7.18 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|