C22H23Cl2N3O3 — CID 4503375
2-(2,4-dichlorophenoxy)-N-[2-hydroxy-5-methyl-1-(3-methylbutyl)indol-3-yl]iminoacetamide (PubChem CID 4503375) has the molecular formula C22H23Cl2N3O3 and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-hydroxy-5-methyl-1-(3-methylbutyl)indol-3-yl]iminoacetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-hydroxy-5-methyl-1-(3-methylbutyl)indol-3-yl]iminoacetamide |
|---|---|
| PubChem CID | 4503375 |
| Molecular Formula | C22H23Cl2N3O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-hydroxy-5-methyl-1-(3-methylbutyl)indol-3-yl]iminoacetamide |
| SMILES | Cc1ccc2c(c1)c(/N=N/C(=O)COc1ccc(Cl)cc1Cl)c(O)n2CCC(C)C |
| InChI | InChI=1S/C22H23Cl2N3O3/c1-13(2)8-9-27-18-6-4-14(3)10-16(18)21(22(27)29)26-25-20(28)12-30-19-7-5-15(23)11-17(19)24/h4-7,10-11,13,29H,8-9,12H2,1-3H3/b26-25+ |
| InChIKey | DUKVHWHFUOWQEB-OCEACIFDSA-N |
| XLogP | 6.70 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|