C21H19N5O5 — CID 3733593
N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-(4-methyl-2-nitrophenoxy)acetamide (PubChem CID 3733593) has the molecular formula C21H19N5O5 and a molecular weight of 421.41 g/mol. Its IUPAC name is N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-(4-methyl-2-nitrophenoxy)acetamide.
| Compound Name | N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-(4-methyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 3733593 |
| Molecular Formula | C21H19N5O5 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-(4-methyl-2-nitrophenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)/N=N/c2c(O)n(CCCC#N)c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N5O5/c1-14-8-9-18(17(12-14)26(29)30)31-13-19(27)23-24-20-15-6-2-3-7-16(15)25(21(20)28)11-5-4-10-22/h2-3,6-9,12,28H,4-5,11,13H2,1H3/b24-23+ |
| InChIKey | FDIJIFGXHUBRPS-WCWDXBQESA-N |
| XLogP | 4.56 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|