C28H34N4O3 — CID 3936690
N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 3936690) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 3936690 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | N-[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]imino-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)/N=N/c2c(O)n(CCCC#N)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-27(2,3)19-28(4,5)20-12-14-21(15-13-20)35-18-24(33)30-31-25-22-10-6-7-11-23(22)32(26(25)34)17-9-8-16-29/h6-7,10-15,34H,8-9,17-19H2,1-5H3/b31-30+ |
| InChIKey | BIAZRYZDOVTAKA-NVQSTNCTSA-N |
| XLogP | 7.05 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|