C22H25N3O4 — CID 4503166
N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]imino-2-(4-methoxyphenoxy)acetamide (PubChem CID 4503166) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]imino-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]imino-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 4503166 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]imino-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)/N=N/c2c(O)n(CC(C)C)c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-14(2)12-25-19-10-5-15(3)11-18(19)21(22(25)27)24-23-20(26)13-29-17-8-6-16(28-4)7-9-17/h5-11,14,27H,12-13H2,1-4H3/b24-23+ |
| InChIKey | KENXCJHLVDPJPN-WCWDXBQESA-N |
| XLogP | 5.01 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|