C20H20BrN3O3 — CID 4503174
5-bromo-2-hydroxy-N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminobenzamide (PubChem CID 4503174) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminobenzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminobenzamide |
|---|---|
| PubChem CID | 4503174 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminobenzamide |
| SMILES | Cc1ccc2c(c1)c(/N=N/C(=O)c1cc(Br)ccc1O)c(O)n2CC(C)C |
| InChI | InChI=1S/C20H20BrN3O3/c1-11(2)10-24-16-6-4-12(3)8-14(16)18(20(24)27)22-23-19(26)15-9-13(21)5-7-17(15)25/h4-9,11,25,27H,10H2,1-3H3/b23-22+ |
| InChIKey | RWXIOKHVDBIQBG-GHVJWSGMSA-N |
| XLogP | 5.70 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|