C21H21Br2N5O3 — CID 3617745
N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-[1-(4-bromophenyl)ethylideneamino]oxyacetamide (PubChem CID 3617745) has the molecular formula C21H21Br2N5O3 and a molecular weight of 551.24 g/mol. Its IUPAC name is N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-[1-(4-bromophenyl)ethylideneamino]oxyacetamide.
| Compound Name | N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-[1-(4-bromophenyl)ethylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 3617745 |
| Molecular Formula | C21H21Br2N5O3 |
| Molecular Weight | 551.24 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-[1-(4-bromophenyl)ethylideneamino]oxyacetamide |
| SMILES | CC(=NOCC(=O)/N=N/c1c(O)n(CN(C)C)c2ccc(Br)cc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H21Br2N5O3/c1-13(14-4-6-15(22)7-5-14)26-31-11-19(29)24-25-20-17-10-16(23)8-9-18(17)28(21(20)30)12-27(2)3/h4-10,30H,11-12H2,1-3H3/b25-24+,26-13? |
| InChIKey | NRSGGOAWWIDDKK-QJVBTMAASA-N |
| XLogP | 5.44 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|