C24H26Br2N6O3 — CID 136780703
N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[(Z)-1-(4-bromophenyl)ethylideneamino]oxyacetamide (PubChem CID 136780703) has the molecular formula C24H26Br2N6O3 and a molecular weight of 606.32 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[(Z)-1-(4-bromophenyl)ethylideneamino]oxyacetamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[(Z)-1-(4-bromophenyl)ethylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 136780703 |
| Molecular Formula | C24H26Br2N6O3 |
| Molecular Weight | 606.32 g/mol |
| Exact Mass | 604.04 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[(Z)-1-(4-bromophenyl)ethylideneamino]oxyacetamide |
| SMILES | C/C(=N/OCC(=O)/N=N/c1c(O)n(CN2CCN(C)CC2)c2ccc(Br)cc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H26Br2N6O3/c1-16(17-3-5-18(25)6-4-17)29-35-14-22(33)27-28-23-20-13-19(26)7-8-21(20)32(24(23)34)15-31-11-9-30(2)10-12-31/h3-8,13,34H,9-12,14-15H2,1-2H3/b28-27+,29-16- |
| InChIKey | RWAZSSUXJHUOMS-OYARURPSSA-N |
| XLogP | 5.13 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|