C23H24BrN5O3 — CID 135748970
N-[5-bromo-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-2-[(Z)-1-phenylethylideneamino]oxyacetamide (PubChem CID 135748970) has the molecular formula C23H24BrN5O3 and a molecular weight of 498.38 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-2-[(Z)-1-phenylethylideneamino]oxyacetamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-2-[(Z)-1-phenylethylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 135748970 |
| Molecular Formula | C23H24BrN5O3 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-(pyrrolidin-1-ylmethyl)indol-3-yl]imino-2-[(Z)-1-phenylethylideneamino]oxyacetamide |
| SMILES | C/C(=N/OCC(=O)/N=N/c1c(O)n(CN2CCCC2)c2ccc(Br)cc12)c1ccccc1 |
| InChI | InChI=1S/C23H24BrN5O3/c1-16(17-7-3-2-4-8-17)27-32-14-21(30)25-26-22-19-13-18(24)9-10-20(19)29(23(22)31)15-28-11-5-6-12-28/h2-4,7-10,13,31H,5-6,11-12,14-15H2,1H3/b26-25+,27-16- |
| InChIKey | CFFGPNMFWWEACP-MEBIDIEESA-N |
| XLogP | 5.21 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|