C25H29BrN6O4 — CID 4872120
N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[1-(4-methoxyphenyl)ethylideneamino]oxyacetamide (PubChem CID 4872120) has the molecular formula C25H29BrN6O4 and a molecular weight of 557.45 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[1-(4-methoxyphenyl)ethylideneamino]oxyacetamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[1-(4-methoxyphenyl)ethylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 4872120 |
| Molecular Formula | C25H29BrN6O4 |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[(4-methylpiperazin-1-yl)methyl]indol-3-yl]imino-2-[1-(4-methoxyphenyl)ethylideneamino]oxyacetamide |
| SMILES | COc1ccc(C(C)=NOCC(=O)/N=N/c2c(O)n(CN3CCN(C)CC3)c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C25H29BrN6O4/c1-17(18-4-7-20(35-3)8-5-18)29-36-15-23(33)27-28-24-21-14-19(26)6-9-22(21)32(25(24)34)16-31-12-10-30(2)11-13-31/h4-9,14,34H,10-13,15-16H2,1-3H3/b28-27+,29-17? |
| InChIKey | YZLSRUKFQNTKEA-DPWAISGMSA-N |
| XLogP | 4.37 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|