C17H25N5O4S — CID 135437813
[1-[[bis(2-methoxyethyl)amino]methyl]-2-hydroxy-5-methoxyindol-3-yl]iminothiourea (PubChem CID 135437813) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is [1-[[bis(2-methoxyethyl)amino]methyl]-2-hydroxy-5-methoxyindol-3-yl]iminothiourea.
| Compound Name | [1-[[bis(2-methoxyethyl)amino]methyl]-2-hydroxy-5-methoxyindol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 135437813 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [1-[[bis(2-methoxyethyl)amino]methyl]-2-hydroxy-5-methoxyindol-3-yl]iminothiourea |
| SMILES | COCCN(CCOC)Cn1c(O)c(/N=N/C(N)=S)c2cc(OC)ccc21 |
| InChI | InChI=1S/C17H25N5O4S/c1-24-8-6-21(7-9-25-2)11-22-14-5-4-12(26-3)10-13(14)15(16(22)23)19-20-17(18)27/h4-5,10,23H,6-9,11H2,1-3H3,(H2,18,27)/b20-19+ |
| InChIKey | COLHECXVMIZCDH-FMQUCBEESA-N |
| XLogP | 2.24 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|