C12H13FN4OS — CID 953934
(5-fluoro-2-hydroxy-1-propylindol-3-yl)iminothiourea (PubChem CID 953934) has the molecular formula C12H13FN4OS and a molecular weight of 280.33 g/mol. Its IUPAC name is (5-fluoro-2-hydroxy-1-propylindol-3-yl)iminothiourea.
| Compound Name | (5-fluoro-2-hydroxy-1-propylindol-3-yl)iminothiourea |
|---|---|
| PubChem CID | 953934 |
| Molecular Formula | C12H13FN4OS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (5-fluoro-2-hydroxy-1-propylindol-3-yl)iminothiourea |
| SMILES | CCCn1c(O)c(/N=N/C(N)=S)c2cc(F)ccc21 |
| InChI | InChI=1S/C12H13FN4OS/c1-2-5-17-9-4-3-7(13)6-8(9)10(11(17)18)15-16-12(14)19/h3-4,6,18H,2,5H2,1H3,(H2,14,19)/b16-15+ |
| InChIKey | DOUNIUAEGBUBCR-FOCLMDBBSA-N |
| XLogP | 3.22 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|