C18H18N4O2S — CID 135629735
[2-hydroxy-1-(3-phenoxypropyl)indol-3-yl]iminothiourea (PubChem CID 135629735) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is [2-hydroxy-1-(3-phenoxypropyl)indol-3-yl]iminothiourea.
| Compound Name | [2-hydroxy-1-(3-phenoxypropyl)indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 135629735 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-hydroxy-1-(3-phenoxypropyl)indol-3-yl]iminothiourea |
| SMILES | NC(=S)/N=N/c1c(O)n(CCCOc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C18H18N4O2S/c19-18(25)21-20-16-14-9-4-5-10-15(14)22(17(16)23)11-6-12-24-13-7-2-1-3-8-13/h1-5,7-10,23H,6,11-12H2,(H2,19,25)/b21-20+ |
| InChIKey | PPJNLOFWRADBBJ-QZQOTICOSA-N |
| XLogP | 4.14 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|