C17H22N4O2S2 — CID 141477245
methyl N-[2-hydroxy-5-methoxy-1-(2-pyrrolidin-1-ylethyl)indol-3-yl]iminocarbamodithioate (PubChem CID 141477245) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is methyl N-[2-hydroxy-5-methoxy-1-(2-pyrrolidin-1-ylethyl)indol-3-yl]iminocarbamodithioate.
| Compound Name | methyl N-[2-hydroxy-5-methoxy-1-(2-pyrrolidin-1-ylethyl)indol-3-yl]iminocarbamodithioate |
|---|---|
| PubChem CID | 141477245 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | methyl N-[2-hydroxy-5-methoxy-1-(2-pyrrolidin-1-ylethyl)indol-3-yl]iminocarbamodithioate |
| SMILES | COc1ccc2c(c1)c(/N=N/C(=S)SC)c(O)n2CCN1CCCC1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-23-12-5-6-14-13(11-12)15(18-19-17(24)25-2)16(22)21(14)10-9-20-7-3-4-8-20/h5-6,11,22H,3-4,7-10H2,1-2H3/b19-18+ |
| InChIKey | CENMSRCAKYGZKO-VHEBQXMUSA-N |
| XLogP | 4.18 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|