C16H18Br2N4O2S2 — CID 141477237
methyl N-[5,7-dibromo-2-hydroxy-1-(2-morpholin-4-ylethyl)indol-3-yl]iminocarbamodithioate (PubChem CID 141477237) has the molecular formula C16H18Br2N4O2S2 and a molecular weight of 522.29 g/mol. Its IUPAC name is methyl N-[5,7-dibromo-2-hydroxy-1-(2-morpholin-4-ylethyl)indol-3-yl]iminocarbamodithioate.
| Compound Name | methyl N-[5,7-dibromo-2-hydroxy-1-(2-morpholin-4-ylethyl)indol-3-yl]iminocarbamodithioate |
|---|---|
| PubChem CID | 141477237 |
| Molecular Formula | C16H18Br2N4O2S2 |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 519.92 |
| IUPAC Name | methyl N-[5,7-dibromo-2-hydroxy-1-(2-morpholin-4-ylethyl)indol-3-yl]iminocarbamodithioate |
| SMILES | CSC(=S)/N=N/c1c(O)n(CCN2CCOCC2)c2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C16H18Br2N4O2S2/c1-26-16(25)20-19-13-11-8-10(17)9-12(18)14(11)22(15(13)23)3-2-21-4-6-24-7-5-21/h8-9,23H,2-7H2,1H3/b20-19+ |
| InChIKey | QHSNAIBIRAMQTD-FMQUCBEESA-N |
| XLogP | 4.94 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|