C22H31N5O4S2 — CID 141477251
tert-butyl 4-[2-[2-hydroxy-5-methoxy-3-(methylsulfanylcarbothioyldiazenyl)indol-1-yl]ethyl]piperazine-1-carboxylate (PubChem CID 141477251) has the molecular formula C22H31N5O4S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-hydroxy-5-methoxy-3-(methylsulfanylcarbothioyldiazenyl)indol-1-yl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-hydroxy-5-methoxy-3-(methylsulfanylcarbothioyldiazenyl)indol-1-yl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141477251 |
| Molecular Formula | C22H31N5O4S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | tert-butyl 4-[2-[2-hydroxy-5-methoxy-3-(methylsulfanylcarbothioyldiazenyl)indol-1-yl]ethyl]piperazine-1-carboxylate |
| SMILES | COc1ccc2c(c1)c(/N=N/C(=S)SC)c(O)n2CCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H31N5O4S2/c1-22(2,3)31-21(29)26-11-8-25(9-12-26)10-13-27-17-7-6-15(30-4)14-16(17)18(19(27)28)23-24-20(32)33-5/h6-7,14,28H,8-13H2,1-5H3/b24-23+ |
| InChIKey | GNDWQZWFSCSHNO-WCWDXBQESA-N |
| XLogP | 4.64 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|