C19H26N4OS2 — CID 141477259
methyl N-[2-hydroxy-5-methyl-1-[2-(2-methylpiperidin-1-yl)ethyl]indol-3-yl]iminocarbamodithioate (PubChem CID 141477259) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is methyl N-[2-hydroxy-5-methyl-1-[2-(2-methylpiperidin-1-yl)ethyl]indol-3-yl]iminocarbamodithioate.
| Compound Name | methyl N-[2-hydroxy-5-methyl-1-[2-(2-methylpiperidin-1-yl)ethyl]indol-3-yl]iminocarbamodithioate |
|---|---|
| PubChem CID | 141477259 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl N-[2-hydroxy-5-methyl-1-[2-(2-methylpiperidin-1-yl)ethyl]indol-3-yl]iminocarbamodithioate |
| SMILES | CSC(=S)/N=N/c1c(O)n(CCN2CCCCC2C)c2ccc(C)cc12 |
| InChI | InChI=1S/C19H26N4OS2/c1-13-7-8-16-15(12-13)17(20-21-19(25)26-3)18(24)23(16)11-10-22-9-5-4-6-14(22)2/h7-8,12,14,24H,4-6,9-11H2,1-3H3/b21-20+ |
| InChIKey | BENQYUZLSRFNMX-QZQOTICOSA-N |
| XLogP | 5.26 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|