C30H32FN7O5S — CID 135465395
7-[4-[[3-(carbamothioyldiazenyl)-2-hydroxy-5-methylindol-1-yl]methyl]-3-methylpiperazin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 135465395) has the molecular formula C30H32FN7O5S and a molecular weight of 621.70 g/mol. Its IUPAC name is 7-[4-[[3-(carbamothioyldiazenyl)-2-hydroxy-5-methylindol-1-yl]methyl]-3-methylpiperazin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-[[3-(carbamothioyldiazenyl)-2-hydroxy-5-methylindol-1-yl]methyl]-3-methylpiperazin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 135465395 |
| Molecular Formula | C30H32FN7O5S |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | 7-[4-[[3-(carbamothioyldiazenyl)-2-hydroxy-5-methylindol-1-yl]methyl]-3-methylpiperazin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(Cn3c(O)c(/N=N/C(N)=S)c4cc(C)ccc43)C(C)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C30H32FN7O5S/c1-15-4-7-22-18(10-15)23(33-34-30(32)44)28(40)38(22)14-36-9-8-35(12-16(36)2)25-21(31)11-19-24(27(25)43-3)37(17-5-6-17)13-20(26(19)39)29(41)42/h4,7,10-11,13,16-17,40H,5-6,8-9,12,14H2,1-3H3,(H2,32,44)(H,41,42)/b34-33+ |
| InChIKey | ITRVWESFXRRSRK-JEIPZWNWSA-N |
| XLogP | 4.65 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|