C18H24N2O3 — CID 139316741
tert-butyl 8-methoxy-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 139316741) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 8-methoxy-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl 8-methoxy-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 139316741 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 8-methoxy-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | COc1ccc2c(c1)c1c(n2C)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)23-17(21)20-9-8-16-14(11-20)13-10-12(22-5)6-7-15(13)19(16)4/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | YLHAUBLVIWDXCB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|