C27H30F3N5O3 — CID 143833729
tert-butyl 7-[4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-2-oxo-1-pyridinyl]-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 143833729) has the molecular formula C27H30F3N5O3 and a molecular weight of 529.56 g/mol. Its IUPAC name is tert-butyl 7-[4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-2-oxo-1-pyridinyl]-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl 7-[4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-2-oxo-1-pyridinyl]-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 143833729 |
| Molecular Formula | C27H30F3N5O3 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | tert-butyl 7-[4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-2-oxo-1-pyridinyl]-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | Cn1c2c(c3ccc(-n4ccc(/C(N)=C/C=C(\N)C(F)(F)F)cc4=O)cc31)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C27H30F3N5O3/c1-26(2,3)38-25(37)34-11-10-21-19(15-34)18-6-5-17(14-22(18)33(21)4)35-12-9-16(13-24(35)36)20(31)7-8-23(32)27(28,29)30/h5-9,12-14H,10-11,15,31-32H2,1-4H3/b20-7-,23-8- |
| InChIKey | IFQGKQPZDQSIDT-BDKOJJTGSA-N |
| XLogP | 4.33 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|