C24H27N5O — CID 88778701
4-[(1Z,3Z)-4-amino-1-(methylideneamino)penta-1,3-dienyl]-1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)pyridin-2-one (PubChem CID 88778701) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-[(1Z,3Z)-4-amino-1-(methylideneamino)penta-1,3-dienyl]-1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)pyridin-2-one.
| Compound Name | 4-[(1Z,3Z)-4-amino-1-(methylideneamino)penta-1,3-dienyl]-1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)pyridin-2-one |
|---|---|
| PubChem CID | 88778701 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-[(1Z,3Z)-4-amino-1-(methylideneamino)penta-1,3-dienyl]-1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)pyridin-2-one |
| SMILES | C=N/C(=C\C=C(\C)N)c1ccn(-c2ccc3c4c(n(C)c3c2)CCN(C)C4)c(=O)c1 |
| InChI | InChI=1S/C24H27N5O/c1-16(25)5-8-21(26-2)17-9-12-29(24(30)13-17)18-6-7-19-20-15-27(3)11-10-22(20)28(4)23(19)14-18/h5-9,12-14H,2,10-11,15,25H2,1,3-4H3/b16-5-,21-8- |
| InChIKey | XTKSCUGHQHANAY-KPJFLFCWSA-N |
| XLogP | 3.22 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|