C25H23FN4O3 — CID 130231421
1-(2-acetyl-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-[(6-fluoro-3-pyridinyl)methoxy]pyridin-2-one (PubChem CID 130231421) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 1-(2-acetyl-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-[(6-fluoro-3-pyridinyl)methoxy]pyridin-2-one.
| Compound Name | 1-(2-acetyl-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-[(6-fluoro-3-pyridinyl)methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 130231421 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-(2-acetyl-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-[(6-fluoro-3-pyridinyl)methoxy]pyridin-2-one |
| SMILES | CC(=O)N1CCc2c(c3ccc(-n4ccc(OCc5ccc(F)nc5)cc4=O)cc3n2C)C1 |
| InChI | InChI=1S/C25H23FN4O3/c1-16(31)29-9-8-22-21(14-29)20-5-4-18(11-23(20)28(22)2)30-10-7-19(12-25(30)32)33-15-17-3-6-24(26)27-13-17/h3-7,10-13H,8-9,14-15H2,1-2H3 |
| InChIKey | ZBNSEBGIHMTTSI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|