C29H36N4O3 — CID 67986818
tert-butyl 5-methyl-7-[2-oxo-4-(2-phenylethyl)piperazin-1-yl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 67986818) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl 5-methyl-7-[2-oxo-4-(2-phenylethyl)piperazin-1-yl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl 5-methyl-7-[2-oxo-4-(2-phenylethyl)piperazin-1-yl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67986818 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | tert-butyl 5-methyl-7-[2-oxo-4-(2-phenylethyl)piperazin-1-yl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | Cn1c2c(c3ccc(N4CCN(CCc5ccccc5)CC4=O)cc31)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C29H36N4O3/c1-29(2,3)36-28(35)32-15-13-25-24(19-32)23-11-10-22(18-26(23)30(25)4)33-17-16-31(20-27(33)34)14-12-21-8-6-5-7-9-21/h5-11,18H,12-17,19-20H2,1-4H3 |
| InChIKey | ZFFPLTXOVLIPGG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|