C25H30N4O — CID 57383294
1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(2-phenylethyl)piperazin-2-one (PubChem CID 57383294) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(2-phenylethyl)piperazin-2-one.
| Compound Name | 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(2-phenylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 57383294 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(2-phenylethyl)piperazin-2-one |
| SMILES | CN1CCc2c(n(C)c3cc(N4CCN(CCc5ccccc5)CC4=O)ccc23)C1 |
| InChI | InChI=1S/C25H30N4O/c1-26-12-11-22-21-9-8-20(16-23(21)27(2)24(22)17-26)29-15-14-28(18-25(29)30)13-10-19-6-4-3-5-7-19/h3-9,16H,10-15,17-18H2,1-2H3 |
| InChIKey | IKQSLXYAXTVNJA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|