C21H25N5OS — CID 135471280
[1-[[benzyl(ethyl)amino]methyl]-2-hydroxy-4,5-dimethylindol-3-yl]iminothiourea (PubChem CID 135471280) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is [1-[[benzyl(ethyl)amino]methyl]-2-hydroxy-4,5-dimethylindol-3-yl]iminothiourea.
| Compound Name | [1-[[benzyl(ethyl)amino]methyl]-2-hydroxy-4,5-dimethylindol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 135471280 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [1-[[benzyl(ethyl)amino]methyl]-2-hydroxy-4,5-dimethylindol-3-yl]iminothiourea |
| SMILES | CCN(Cc1ccccc1)Cn1c(O)c(/N=N/C(N)=S)c2c(C)c(C)ccc21 |
| InChI | InChI=1S/C21H25N5OS/c1-4-25(12-16-8-6-5-7-9-16)13-26-17-11-10-14(2)15(3)18(17)19(20(26)27)23-24-21(22)28/h5-11,27H,4,12-13H2,1-3H3,(H2,22,28)/b24-23+ |
| InChIKey | RYUBYCUMKSGFSJ-WCWDXBQESA-N |
| XLogP | 4.77 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|