C25H29N5OS — CID 135442772
[1-[(4-benzylpiperidin-1-yl)methyl]-2-hydroxy-6,7-dihydro-5H-cyclopenta[f]indol-3-yl]iminothiourea (PubChem CID 135442772) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is [1-[(4-benzylpiperidin-1-yl)methyl]-2-hydroxy-6,7-dihydro-5H-cyclopenta[f]indol-3-yl]iminothiourea.
| Compound Name | [1-[(4-benzylpiperidin-1-yl)methyl]-2-hydroxy-6,7-dihydro-5H-cyclopenta[f]indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 135442772 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [1-[(4-benzylpiperidin-1-yl)methyl]-2-hydroxy-6,7-dihydro-5H-cyclopenta[f]indol-3-yl]iminothiourea |
| SMILES | NC(=S)/N=N/c1c(O)n(CN2CCC(Cc3ccccc3)CC2)c2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C25H29N5OS/c26-25(32)28-27-23-21-14-19-7-4-8-20(19)15-22(21)30(24(23)31)16-29-11-9-18(10-12-29)13-17-5-2-1-3-6-17/h1-3,5-6,14-15,18,31H,4,7-13,16H2,(H2,26,32)/b28-27+ |
| InChIKey | MAYABQQCPJVICE-BYYHNAKLSA-N |
| XLogP | 5.08 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|