C20H23N5O2 — CID 135734527
N-[1-[2-(diethylamino)ethyl]-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide (PubChem CID 135734527) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide |
|---|---|
| PubChem CID | 135734527 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide |
| SMILES | CCN(CC)CCn1c(O)c(/N=N/C(=O)c2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C20H23N5O2/c1-3-24(4-2)13-14-25-17-11-6-5-9-15(17)18(20(25)27)22-23-19(26)16-10-7-8-12-21-16/h5-12,27H,3-4,13-14H2,1-2H3/b23-22+ |
| InChIKey | UXNQTWJYDASENQ-GHVJWSGMSA-N |
| XLogP | 4.01 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|