C25H31N5OS — CID 136754531
1-(2,3-dimethylphenyl)-3-[1-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea (PubChem CID 136754531) has the molecular formula C25H31N5OS and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[1-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[1-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 136754531 |
| Molecular Formula | C25H31N5OS |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[1-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea |
| SMILES | Cc1cccc(NC(=S)/N=N/c2c(O)n(CN3C[C@H](C)C[C@@H](C)C3)c3ccccc23)c1C |
| InChI | InChI=1S/C25H31N5OS/c1-16-12-17(2)14-29(13-16)15-30-22-11-6-5-9-20(22)23(24(30)31)27-28-25(32)26-21-10-7-8-18(3)19(21)4/h5-11,16-17,31H,12-15H2,1-4H3,(H,26,32)/b28-27+/t16-,17-/m1/s1 |
| InChIKey | JVELUDSMABVHAH-VLGQYRSUSA-N |
| XLogP | 6.38 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|