C28H30FN6OS+ — CID 4615318
1-(2,4-dimethylphenyl)-3-[1-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea (PubChem CID 4615318) has the molecular formula C28H30FN6OS+ and a molecular weight of 517.65 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[1-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[1-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 4615318 |
| Molecular Formula | C28H30FN6OS+ |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[1-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-2-hydroxyindol-3-yl]iminothiourea |
| SMILES | Cc1ccc(NC(=S)/N=N/c2c(O)n(C[NH+]3CCN(c4ccccc4F)CC3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C28H29FN6OS/c1-19-11-12-23(20(2)17-19)30-28(37)32-31-26-21-7-3-5-9-24(21)35(27(26)36)18-33-13-15-34(16-14-33)25-10-6-4-8-22(25)29/h3-12,17,36H,13-16,18H2,1-2H3,(H,30,37)/p+1/b32-31+ |
| InChIKey | PKVNWXWEAUQIDF-QNEJGDQOSA-O |
| XLogP | 4.95 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|