C25H22N4O4 — CID 4264369
N-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2-hydroxyindol-3-yl]imino-2-hydroxybenzamide (PubChem CID 4264369) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2-hydroxyindol-3-yl]imino-2-hydroxybenzamide.
| Compound Name | N-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2-hydroxyindol-3-yl]imino-2-hydroxybenzamide |
|---|---|
| PubChem CID | 4264369 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2-hydroxyindol-3-yl]imino-2-hydroxybenzamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(O)c(/N=N/C(=O)c3ccccc3O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H22N4O4/c1-15-11-12-19(16(2)13-15)26-22(31)14-29-20-9-5-3-7-17(20)23(25(29)33)27-28-24(32)18-8-4-6-10-21(18)30/h3-13,30,33H,14H2,1-2H3,(H,26,31)/b28-27+ |
| InChIKey | SBYQFRCTUBJNKT-BYYHNAKLSA-N |
| XLogP | 5.23 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|