C17H12N3O5- — CID 4090975
2-[2-hydroxy-3-[(2-hydroxybenzoyl)diazenyl]indol-1-yl]acetate (PubChem CID 4090975) has the molecular formula C17H12N3O5- and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[(2-hydroxybenzoyl)diazenyl]indol-1-yl]acetate.
| Compound Name | 2-[2-hydroxy-3-[(2-hydroxybenzoyl)diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 4090975 |
| Molecular Formula | C17H12N3O5- |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-[2-hydroxy-3-[(2-hydroxybenzoyl)diazenyl]indol-1-yl]acetate |
| SMILES | O=C([O-])Cn1c(O)c(/N=N/C(=O)c2ccccc2O)c2ccccc21 |
| InChI | InChI=1S/C17H13N3O5/c21-13-8-4-2-6-11(13)16(24)19-18-15-10-5-1-3-7-12(10)20(17(15)25)9-14(22)23/h1-8,21,25H,9H2,(H,22,23)/p-1/b19-18+ |
| InChIKey | KEQURQCGGIJAAJ-VHEBQXMUSA-M |
| XLogP | 1.73 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|