C29H30F3N6OS+ — CID 4615320
1-(2,4-dimethylphenyl)-3-[2-hydroxy-1-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]indol-3-yl]iminothiourea (PubChem CID 4615320) has the molecular formula C29H30F3N6OS+ and a molecular weight of 567.66 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[2-hydroxy-1-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]indol-3-yl]iminothiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[2-hydroxy-1-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 4615320 |
| Molecular Formula | C29H30F3N6OS+ |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[2-hydroxy-1-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]indol-3-yl]iminothiourea |
| SMILES | Cc1ccc(NC(=S)/N=N/c2c(O)n(C[NH+]3CCN(c4cccc(C(F)(F)F)c4)CC3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C29H29F3N6OS/c1-19-10-11-24(20(2)16-19)33-28(40)35-34-26-23-8-3-4-9-25(23)38(27(26)39)18-36-12-14-37(15-13-36)22-7-5-6-21(17-22)29(30,31)32/h3-11,16-17,39H,12-15,18H2,1-2H3,(H,33,40)/p+1/b35-34+ |
| InChIKey | FFNGHGSMYVSRMM-XAHDOWKMSA-O |
| XLogP | 5.83 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|