C18H18N4O4S — CID 173009127
1-[(3-hydroxy-1H-indol-2-yl)imino]-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 173009127) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is 1-[(3-hydroxy-1H-indol-2-yl)imino]-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-[(3-hydroxy-1H-indol-2-yl)imino]-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 173009127 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[(3-hydroxy-1H-indol-2-yl)imino]-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)N=Nc2[nH]c3ccccc3c2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N4O4S/c1-24-13-8-10(9-14(25-2)16(13)26-3)19-18(27)22-21-17-15(23)11-6-4-5-7-12(11)20-17/h4-9,20,23H,1-3H3,(H,19,27) |
| InChIKey | TYWUMLVFSDOXOI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|