C17H17N3O4S — CID 135775393
4-ethoxy-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzenesulfonamide (PubChem CID 135775393) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-ethoxy-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzenesulfonamide |
|---|---|
| PubChem CID | 135775393 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-ethoxy-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)/N=N/c2c(O)[nH]c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C17H17N3O4S/c1-3-24-12-5-7-13(8-6-12)25(22,23)20-19-16-14-10-11(2)4-9-15(14)18-17(16)21/h4-10,18,21H,3H2,1-2H3/b20-19+ |
| InChIKey | WDVHVHUONPZJMJ-FMQUCBEESA-N |
| XLogP | 4.05 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|