C18H16FN3O5 — CID 135836838
N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide (PubChem CID 135836838) has the molecular formula C18H16FN3O5 and a molecular weight of 373.34 g/mol. Its IUPAC name is N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135836838 |
| Molecular Formula | C18H16FN3O5 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)/N=N/c2c(O)[nH]c3cc(F)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H16FN3O5/c1-25-13-6-9(7-14(26-2)16(13)27-3)17(23)22-21-15-11-5-4-10(19)8-12(11)20-18(15)24/h4-8,20,24H,1-3H3/b22-21+ |
| InChIKey | AYHFYJQBYGKERJ-QURGRASLSA-N |
| XLogP | 3.96 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|