C19H18FN3O2S — CID 135677318
N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 135677318) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135677318 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2cc(F)ccc12)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C19H18FN3O2S/c20-12-7-8-13-14(10-12)21-19(25)17(13)22-23-18(24)16-9-11-5-3-1-2-4-6-15(11)26-16/h7-10,21,25H,1-6H2/b23-22+ |
| InChIKey | FNXTWWQKRNERSI-GHVJWSGMSA-N |
| XLogP | 5.66 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|