C18H17N3O2S — CID 135958305
N-(2-hydroxy-1-methylindol-3-yl)imino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 135958305) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(2-hydroxy-1-methylindol-3-yl)imino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-hydroxy-1-methylindol-3-yl)imino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135958305 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(2-hydroxy-1-methylindol-3-yl)imino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)c2cc3c(s2)CCCC3)c2ccccc21 |
| InChI | InChI=1S/C18H17N3O2S/c1-21-13-8-4-3-7-12(13)16(18(21)23)19-20-17(22)15-10-11-6-2-5-9-14(11)24-15/h3-4,7-8,10,23H,2,5-6,9H2,1H3/b20-19+ |
| InChIKey | JFKFOUZZUZZKFJ-FMQUCBEESA-N |
| XLogP | 4.75 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|