C25H21N3O2 — CID 3821867
N-(2-hydroxy-1-methylindol-3-yl)imino-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 3821867) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(2-hydroxy-1-methylindol-3-yl)imino-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3821867 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(2-hydroxy-1-methylindol-3-yl)imino-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)C2CC2(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2/c1-28-21-15-9-8-14-19(21)22(24(28)30)26-27-23(29)20-16-25(20,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15,20,30H,16H2,1H3/b27-26+ |
| InChIKey | JPANURIWFCKLEH-CYYJNZCTSA-N |
| XLogP | 5.50 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|