C20H17N5O3 — CID 135847909
N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 135847909) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 135847909 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[(2-hydroxy-5-propan-2-yl-1H-indol-3-yl)imino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CC(C)c1ccc2[nH]c(O)c(/N=N/C(=O)c3n[nH]c(=O)c4ccccc34)c2c1 |
| InChI | InChI=1S/C20H17N5O3/c1-10(2)11-7-8-15-14(9-11)17(19(27)21-15)23-25-20(28)16-12-5-3-4-6-13(12)18(26)24-22-16/h3-10,21,27H,1-2H3,(H,24,26)/b25-23+ |
| InChIKey | PPEUCUCICAEQFH-WJTDDFOZSA-N |
| XLogP | 4.16 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|