C18H16F3N3O — CID 135775276
5-propan-2-yl-3-[[2-(trifluoromethyl)phenyl]diazenyl]-1H-indol-2-ol (PubChem CID 135775276) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 5-propan-2-yl-3-[[2-(trifluoromethyl)phenyl]diazenyl]-1H-indol-2-ol.
| Compound Name | 5-propan-2-yl-3-[[2-(trifluoromethyl)phenyl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135775276 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 5-propan-2-yl-3-[[2-(trifluoromethyl)phenyl]diazenyl]-1H-indol-2-ol |
| SMILES | CC(C)c1ccc2[nH]c(O)c(/N=N/c3ccccc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C18H16F3N3O/c1-10(2)11-7-8-14-12(9-11)16(17(25)22-14)24-23-15-6-4-3-5-13(15)18(19,20)21/h3-10,22,25H,1-2H3/b24-23+ |
| InChIKey | GJDBAGWCYTUJJU-WCWDXBQESA-N |
| XLogP | 6.43 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|