C24H22N8O8 — CID 135544236
N,N'-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]octanediamide (PubChem CID 135544236) has the molecular formula C24H22N8O8 and a molecular weight of 550.49 g/mol. Its IUPAC name is N,N'-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]octanediamide.
| Compound Name | N,N'-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]octanediamide |
|---|---|
| PubChem CID | 135544236 |
| Molecular Formula | C24H22N8O8 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N,N'-bis[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)/N=N/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12)/N=N/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C24H22N8O8/c33-19(27-29-21-15-11-13(31(37)38)7-9-17(15)25-23(21)35)5-3-1-2-4-6-20(34)28-30-22-16-12-14(32(39)40)8-10-18(16)26-24(22)36/h7-12,25-26,35-36H,1-6H2/b29-27+,30-28+ |
| InChIKey | GVBJWZWXSAAXCM-QAVVBOBSSA-N |
| XLogP | 6.14 |
| TPSA | 241.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|