C22H22N4O5 — CID 137034767
2-(4-cyclohexylphenoxy)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide (PubChem CID 137034767) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-(4-cyclohexylphenoxy)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide.
| Compound Name | 2-(4-cyclohexylphenoxy)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide |
|---|---|
| PubChem CID | 137034767 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-(4-cyclohexylphenoxy)-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]acetamide |
| SMILES | O=C(COc1ccc(C2CCCCC2)cc1)/N=N/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C22H22N4O5/c27-20(13-31-17-9-6-15(7-10-17)14-4-2-1-3-5-14)24-25-21-18-12-16(26(29)30)8-11-19(18)23-22(21)28/h6-12,14,23,28H,1-5,13H2/b25-24+ |
| InChIKey | SBAVRKUBFOLSJD-OCOZRVBESA-N |
| XLogP | 5.52 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|